About 6-triethoxysilylhexyl (E)-3-[4-(4-methoxy-3-octoxyphenyl)phenyl]prop-2-enoate
6-triethoxysilylhexyl (E)-3-[4-(4-methoxy-3-octoxyphenyl)phenyl]prop-2-enoate (PubChem CID 140988143) has the molecular formula C36H56O7Si
and a molecular weight of 628.92 g/mol. Its IUPAC name is 6-triethoxysilylhexyl (E)-3-[4-(4-methoxy-3-octoxyphenyl)phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | 6-triethoxysilylhexyl (E)-3-[4-(4-methoxy-3-octoxyphenyl)phenyl]prop-2-enoate |
| PubChem CID | 140988143 |
| Molecular Formula | C36H56O7Si |
| Molecular Weight | 628.92 g/mol |
| Exact Mass | 628.38 |
| IUPAC Name | 6-triethoxysilylhexyl (E)-3-[4-(4-methoxy-3-octoxyphenyl)phenyl]prop-2-enoate |
| SMILES | CCCCCCCCOc1cc(-c2ccc(/C=C/C(=O)OCCCCCC[Si](OCC)(OCC)OCC)cc2)ccc1OC |
| InChI | InChI=1S/C36H56O7Si/c1-6-10-11-12-13-16-27-39-35-30-33(24-25-34(35)38-5)32-22-19-31(20-23-32)21-26-36(37)40-28-17-14-15-18-29-44(41-7-2,42-8-3)43-9-4/h19-26,30H,6-18,27-29H2,1-5H3/b26-21+ |
| InChIKey | HRUXYZVFKAYGKB-YYADALCUSA-N |
| XLogP | 9.27 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 628.92 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-triethoxysilylhexyl (E)-3-[4-(4-methoxy-3-octoxyphenyl)phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-triethoxysilylhexyl (E)-3-[4-(4-methoxy-3-octoxyphenyl)phenyl]prop-2-enoate?
The IUPAC name of 6-triethoxysilylhexyl (E)-3-[4-(4-methoxy-3-octoxyphenyl)phenyl]prop-2-enoate (CID 140988143) is 6-triethoxysilylhexyl (E)-3-[4-(4-methoxy-3-octoxyphenyl)phenyl]prop-2-enoate.
What is the SMILES notation for 6-triethoxysilylhexyl (E)-3-[4-(4-methoxy-3-octoxyphenyl)phenyl]prop-2-enoate?
The canonical SMILES for 6-triethoxysilylhexyl (E)-3-[4-(4-methoxy-3-octoxyphenyl)phenyl]prop-2-enoate is CCCCCCCCOc1cc(-c2ccc(/C=C/C(=O)OCCCCCC[Si](OCC)(OCC)OCC)cc2)ccc1OC.
What is the InChIKey of 6-triethoxysilylhexyl (E)-3-[4-(4-methoxy-3-octoxyphenyl)phenyl]prop-2-enoate?
The InChIKey is HRUXYZVFKAYGKB-YYADALCUSA-N. The full InChI is InChI=1S/C36H56O7Si/c1-6-10-11-12-13-16-27-39-35-30-33(24-25-34(35)38-5)32-22-19-31(20-23-32)21-26-36(37)40-28-17-14-15-18-29-44(41-7-2,42-8-3)43-9-4/h19-26,30H,6-18,27-29H2,1-5H3/b26-21+.
What are the key properties of 6-triethoxysilylhexyl (E)-3-[4-(4-methoxy-3-octoxyphenyl)phenyl]prop-2-enoate?
6-triethoxysilylhexyl (E)-3-[4-(4-methoxy-3-octoxyphenyl)phenyl]prop-2-enoate has a molecular weight of 628.92 g/mol, XLogP of 9.27, 25 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-triethoxysilylhexyl (E)-3-[4-(4-methoxy-3-octoxyphenyl)phenyl]prop-2-enoate is sourced from PubChem (CID 140988143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).