About 6-trichlorosilylhexyl (E)-3-[4-(3-hexoxy-4-methoxyphenyl)phenyl]prop-2-enoate
6-trichlorosilylhexyl (E)-3-[4-(3-hexoxy-4-methoxyphenyl)phenyl]prop-2-enoate (PubChem CID 140988117) has the molecular formula C28H37Cl3O4Si
and a molecular weight of 572.05 g/mol. Its IUPAC name is 6-trichlorosilylhexyl (E)-3-[4-(3-hexoxy-4-methoxyphenyl)phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | 6-trichlorosilylhexyl (E)-3-[4-(3-hexoxy-4-methoxyphenyl)phenyl]prop-2-enoate |
| PubChem CID | 140988117 |
| Molecular Formula | C28H37Cl3O4Si |
| Molecular Weight | 572.05 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 6-trichlorosilylhexyl (E)-3-[4-(3-hexoxy-4-methoxyphenyl)phenyl]prop-2-enoate |
| SMILES | CCCCCCOc1cc(-c2ccc(/C=C/C(=O)OCCCCCC[Si](Cl)(Cl)Cl)cc2)ccc1OC |
| InChI | InChI=1S/C28H37Cl3O4Si/c1-3-4-5-8-19-34-27-22-25(16-17-26(27)33-2)24-14-11-23(12-15-24)13-18-28(32)35-20-9-6-7-10-21-36(29,30)31/h11-18,22H,3-10,19-21H2,1-2H3/b18-13+ |
| InChIKey | NBVIZHPWXKCVJS-QGOAFFKASA-N |
| XLogP | 9.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.05 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 6-trichlorosilylhexyl (E)-3-[4-(3-hexoxy-4-methoxyphenyl)phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-trichlorosilylhexyl (E)-3-[4-(3-hexoxy-4-methoxyphenyl)phenyl]prop-2-enoate?
The IUPAC name of 6-trichlorosilylhexyl (E)-3-[4-(3-hexoxy-4-methoxyphenyl)phenyl]prop-2-enoate (CID 140988117) is 6-trichlorosilylhexyl (E)-3-[4-(3-hexoxy-4-methoxyphenyl)phenyl]prop-2-enoate.
What is the SMILES notation for 6-trichlorosilylhexyl (E)-3-[4-(3-hexoxy-4-methoxyphenyl)phenyl]prop-2-enoate?
The canonical SMILES for 6-trichlorosilylhexyl (E)-3-[4-(3-hexoxy-4-methoxyphenyl)phenyl]prop-2-enoate is CCCCCCOc1cc(-c2ccc(/C=C/C(=O)OCCCCCC[Si](Cl)(Cl)Cl)cc2)ccc1OC.
What is the InChIKey of 6-trichlorosilylhexyl (E)-3-[4-(3-hexoxy-4-methoxyphenyl)phenyl]prop-2-enoate?
The InChIKey is NBVIZHPWXKCVJS-QGOAFFKASA-N. The full InChI is InChI=1S/C28H37Cl3O4Si/c1-3-4-5-8-19-34-27-22-25(16-17-26(27)33-2)24-14-11-23(12-15-24)13-18-28(32)35-20-9-6-7-10-21-36(29,30)31/h11-18,22H,3-10,19-21H2,1-2H3/b18-13+.
What are the key properties of 6-trichlorosilylhexyl (E)-3-[4-(3-hexoxy-4-methoxyphenyl)phenyl]prop-2-enoate?
6-trichlorosilylhexyl (E)-3-[4-(3-hexoxy-4-methoxyphenyl)phenyl]prop-2-enoate has a molecular weight of 572.05 g/mol, XLogP of 9.09, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-trichlorosilylhexyl (E)-3-[4-(3-hexoxy-4-methoxyphenyl)phenyl]prop-2-enoate is sourced from PubChem (CID 140988117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).