C25H31Cl3O6Si — CID 142627722
6-trichlorosilylhexyl (E)-3-[4-[(3,4-dimethoxyphenyl)methoxy]-3-methoxyphenyl]prop-2-enoate (PubChem CID 142627722) has the molecular formula C25H31Cl3O6Si and a molecular weight of 561.96 g/mol. Its IUPAC name is 6-trichlorosilylhexyl (E)-3-[4-[(3,4-dimethoxyphenyl)methoxy]-3-methoxyphenyl]prop-2-enoate.
| Compound Name | 6-trichlorosilylhexyl (E)-3-[4-[(3,4-dimethoxyphenyl)methoxy]-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 142627722 |
| Molecular Formula | C25H31Cl3O6Si |
| Molecular Weight | 561.96 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | 6-trichlorosilylhexyl (E)-3-[4-[(3,4-dimethoxyphenyl)methoxy]-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1ccc(COc2ccc(/C=C/C(=O)OCCCCCC[Si](Cl)(Cl)Cl)cc2OC)cc1OC |
| InChI | InChI=1S/C25H31Cl3O6Si/c1-30-21-11-9-20(17-23(21)31-2)18-34-22-12-8-19(16-24(22)32-3)10-13-25(29)33-14-6-4-5-7-15-35(26,27)28/h8-13,16-17H,4-7,14-15,18H2,1-3H3/b13-10+ |
| InChIKey | OLRKTLPHXWBEQO-JLHYYAGUSA-N |
| XLogP | 7.06 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.96 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|