C25H29Cl3O7Si — CID 140988184
[2-methoxy-4-[(E)-3-oxo-3-(6-trichlorosilylhexoxy)prop-1-enyl]phenyl] 3,4-dimethoxybenzoate (PubChem CID 140988184) has the molecular formula C25H29Cl3O7Si and a molecular weight of 575.95 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-oxo-3-(6-trichlorosilylhexoxy)prop-1-enyl]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [2-methoxy-4-[(E)-3-oxo-3-(6-trichlorosilylhexoxy)prop-1-enyl]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 140988184 |
| Molecular Formula | C25H29Cl3O7Si |
| Molecular Weight | 575.95 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | [2-methoxy-4-[(E)-3-oxo-3-(6-trichlorosilylhexoxy)prop-1-enyl]phenyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C=C/C(=O)OCCCCCC[Si](Cl)(Cl)Cl)cc2OC)cc1OC |
| InChI | InChI=1S/C25H29Cl3O7Si/c1-31-20-12-10-19(17-23(20)33-3)25(30)35-21-11-8-18(16-22(21)32-2)9-13-24(29)34-14-6-4-5-7-15-36(26,27)28/h8-13,16-17H,4-7,14-15H2,1-3H3/b13-9+ |
| InChIKey | XSRDXNYGMHWXEF-UKTHLTGXSA-N |
| XLogP | 6.70 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.95 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|