C38H54O8 — CID 146228651
[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-[9-(2-tert-butyl-2,3,3-trimethylbutanoyl)oxynonoxy]benzoate (PubChem CID 146228651) has the molecular formula C38H54O8 and a molecular weight of 638.84 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-[9-(2-tert-butyl-2,3,3-trimethylbutanoyl)oxynonoxy]benzoate.
| Compound Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-[9-(2-tert-butyl-2,3,3-trimethylbutanoyl)oxynonoxy]benzoate |
|---|---|
| PubChem CID | 146228651 |
| Molecular Formula | C38H54O8 |
| Molecular Weight | 638.84 g/mol |
| Exact Mass | 638.38 |
| IUPAC Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-[9-(2-tert-butyl-2,3,3-trimethylbutanoyl)oxynonoxy]benzoate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)c2ccc(OCCCCCCCCCOC(=O)C(C)(C(C)(C)C)C(C)(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C38H54O8/c1-36(2,3)38(7,37(4,5)6)35(41)45-26-16-14-12-10-11-13-15-25-44-30-21-19-29(20-22-30)34(40)46-31-23-17-28(27-32(31)42-8)18-24-33(39)43-9/h17-24,27H,10-16,25-26H2,1-9H3/b24-18+ |
| InChIKey | IVAAXAYSCOSJIT-HKOYGPOVSA-N |
| XLogP | 8.85 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.84 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|