C33H41NO8 — CID 122480256
[4-[(E)-3-(2-cyanoethoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-[8-(2-methylbutanoyloxy)octoxy]benzoate (PubChem CID 122480256) has the molecular formula C33H41NO8 and a molecular weight of 579.69 g/mol. Its IUPAC name is [4-[(E)-3-(2-cyanoethoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-[8-(2-methylbutanoyloxy)octoxy]benzoate.
| Compound Name | [4-[(E)-3-(2-cyanoethoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-[8-(2-methylbutanoyloxy)octoxy]benzoate |
|---|---|
| PubChem CID | 122480256 |
| Molecular Formula | C33H41NO8 |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | [4-[(E)-3-(2-cyanoethoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-[8-(2-methylbutanoyloxy)octoxy]benzoate |
| SMILES | CCC(C)C(=O)OCCCCCCCCOc1ccc(C(=O)Oc2ccc(/C=C/C(=O)OCCC#N)cc2OC)cc1 |
| InChI | InChI=1S/C33H41NO8/c1-4-25(2)32(36)41-22-10-8-6-5-7-9-21-39-28-16-14-27(15-17-28)33(37)42-29-18-12-26(24-30(29)38-3)13-19-31(35)40-23-11-20-34/h12-19,24-25H,4-11,21-23H2,1-3H3/b19-13+ |
| InChIKey | SYJCKVKGFXTUAN-CPNJWEJPSA-N |
| XLogP | 6.69 |
| TPSA | 121.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|