C37H40N2O8 — CID 76574853
[4-[5-[4-(3-butoxy-3-oxoprop-1-enyl)phenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-[4-(2-methylbutanoyloxy)butoxy]benzoate (PubChem CID 76574853) has the molecular formula C37H40N2O8 and a molecular weight of 640.73 g/mol. Its IUPAC name is [4-[5-[4-(3-butoxy-3-oxoprop-1-enyl)phenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-[4-(2-methylbutanoyloxy)butoxy]benzoate.
| Compound Name | [4-[5-[4-(3-butoxy-3-oxoprop-1-enyl)phenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-[4-(2-methylbutanoyloxy)butoxy]benzoate |
|---|---|
| PubChem CID | 76574853 |
| Molecular Formula | C37H40N2O8 |
| Molecular Weight | 640.73 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | [4-[5-[4-(3-butoxy-3-oxoprop-1-enyl)phenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-[4-(2-methylbutanoyloxy)butoxy]benzoate |
| SMILES | CCCCOC(=O)C=Cc1ccc(-c2nnc(-c3ccc(OC(=O)c4ccc(OCCCCOC(=O)C(C)CC)cc4)cc3)o2)cc1 |
| InChI | InChI=1S/C37H40N2O8/c1-4-6-23-44-33(40)22-11-27-9-12-28(13-10-27)34-38-39-35(47-34)29-14-20-32(21-15-29)46-37(42)30-16-18-31(19-17-30)43-24-7-8-25-45-36(41)26(3)5-2/h9-22,26H,4-8,23-25H2,1-3H3 |
| InChIKey | UMNFKHVDRUWUMY-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 127.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.73 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|