C36H51NO7 — CID 165103149
(4-cyanophenyl) 4-[4-(2-methylbutanoyloxy)butoxy]benzoate;octyl 2-methylbutanoate (PubChem CID 165103149) has the molecular formula C36H51NO7 and a molecular weight of 609.80 g/mol. Its IUPAC name is (4-cyanophenyl) 4-[4-(2-methylbutanoyloxy)butoxy]benzoate;octyl 2-methylbutanoate.
| Compound Name | (4-cyanophenyl) 4-[4-(2-methylbutanoyloxy)butoxy]benzoate;octyl 2-methylbutanoate |
|---|---|
| PubChem CID | 165103149 |
| Molecular Formula | C36H51NO7 |
| Molecular Weight | 609.80 g/mol |
| Exact Mass | 609.37 |
| IUPAC Name | (4-cyanophenyl) 4-[4-(2-methylbutanoyloxy)butoxy]benzoate;octyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCCCOc1ccc(C(=O)Oc2ccc(C#N)cc2)cc1.CCCCCCCCOC(=O)C(C)CC |
| InChI | InChI=1S/C23H25NO5.C13H26O2/c1-3-17(2)22(25)28-15-5-4-14-27-20-12-8-19(9-13-20)23(26)29-21-10-6-18(16-24)7-11-21;1-4-6-7-8-9-10-11-15-13(14)12(3)5-2/h6-13,17H,3-5,14-15H2,1-2H3;12H,4-11H2,1-3H3 |
| InChIKey | YRHWPKMAUQFEOE-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 111.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.80 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|