C38H33NO10 — CID 168764558
4-O-[4-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]carbonylphenyl] 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate (PubChem CID 168764558) has the molecular formula C38H33NO10 and a molecular weight of 663.68 g/mol. Its IUPAC name is 4-O-[4-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]carbonylphenyl] 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate.
| Compound Name | 4-O-[4-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]carbonylphenyl] 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate |
|---|---|
| PubChem CID | 168764558 |
| Molecular Formula | C38H33NO10 |
| Molecular Weight | 663.68 g/mol |
| Exact Mass | 663.21 |
| IUPAC Name | 4-O-[4-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]carbonylphenyl] 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate |
| SMILES | CCC(C)C(=O)OCCOC(=O)CCC(=O)Oc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(-c4ccc(C#N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H33NO10/c1-3-25(2)36(42)46-23-22-45-34(40)20-21-35(41)47-31-16-10-29(11-17-31)37(43)49-33-18-12-30(13-19-33)38(44)48-32-14-8-28(9-15-32)27-6-4-26(24-39)5-7-27/h4-19,25H,3,20-23H2,1-2H3 |
| InChIKey | GPVCZOGXAFJZSP-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 155.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|