C53H43N3O10 — CID 89086785
bis[2-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]ethyl] 4-cyano-4-methylheptanedioate (PubChem CID 89086785) has the molecular formula C53H43N3O10 and a molecular weight of 881.94 g/mol. Its IUPAC name is bis[2-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]ethyl] 4-cyano-4-methylheptanedioate.
| Compound Name | bis[2-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]ethyl] 4-cyano-4-methylheptanedioate |
|---|---|
| PubChem CID | 89086785 |
| Molecular Formula | C53H43N3O10 |
| Molecular Weight | 881.94 g/mol |
| Exact Mass | 881.29 |
| IUPAC Name | bis[2-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]ethyl] 4-cyano-4-methylheptanedioate |
| SMILES | CC(C#N)(CCC(=O)OCCOc1ccc(C(=O)Oc2ccc(-c3ccc(C#N)cc3)cc2)cc1)CCC(=O)OCCOc1ccc(C(=O)Oc2ccc(-c3ccc(C#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C53H43N3O10/c1-53(36-56,28-26-49(57)63-32-30-61-45-18-14-43(15-19-45)51(59)65-47-22-10-41(11-23-47)39-6-2-37(34-54)3-7-39)29-27-50(58)64-33-31-62-46-20-16-44(17-21-46)52(60)66-48-24-12-42(13-25-48)40-8-4-38(35-55)5-9-40/h2-25H,26-33H2,1H3 |
| InChIKey | WKRFIFHRLHVRMX-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 195.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.94 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|