C57H43N3O9 — CID 143609480
1-O,5-O-bis[4-(4-cyanophenyl)phenyl] 3-O-[2-[4-[4-(4-methylphenyl)phenoxy]carbonylphenoxy]ethyl] 3-cyanopentane-1,3,5-tricarboxylate (PubChem CID 143609480) has the molecular formula C57H43N3O9 and a molecular weight of 913.98 g/mol. Its IUPAC name is 1-O,5-O-bis[4-(4-cyanophenyl)phenyl] 3-O-[2-[4-[4-(4-methylphenyl)phenoxy]carbonylphenoxy]ethyl] 3-cyanopentane-1,3,5-tricarboxylate.
| Compound Name | 1-O,5-O-bis[4-(4-cyanophenyl)phenyl] 3-O-[2-[4-[4-(4-methylphenyl)phenoxy]carbonylphenoxy]ethyl] 3-cyanopentane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 143609480 |
| Molecular Formula | C57H43N3O9 |
| Molecular Weight | 913.98 g/mol |
| Exact Mass | 913.30 |
| IUPAC Name | 1-O,5-O-bis[4-(4-cyanophenyl)phenyl] 3-O-[2-[4-[4-(4-methylphenyl)phenoxy]carbonylphenoxy]ethyl] 3-cyanopentane-1,3,5-tricarboxylate |
| SMILES | Cc1ccc(-c2ccc(OC(=O)c3ccc(OCCOC(=O)C(C#N)(CCC(=O)Oc4ccc(-c5ccc(C#N)cc5)cc4)CCC(=O)Oc4ccc(-c5ccc(C#N)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C57H43N3O9/c1-39-2-8-42(9-3-39)45-18-28-52(29-19-45)69-55(63)48-20-22-49(23-21-48)65-34-35-66-56(64)57(38-60,32-30-53(61)67-50-24-14-46(15-25-50)43-10-4-40(36-58)5-11-43)33-31-54(62)68-51-26-16-47(17-27-51)44-12-6-41(37-59)7-13-44/h2-29H,30-35H2,1H3 |
| InChIKey | XPLLOBBYJJESNI-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 185.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.98 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|