C43H36N2O7 — CID 91607334
5-O-[2-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]ethyl] 1-O-[4-(4-cyanophenyl)phenyl] 2-ethyl-4-methylpentanedioate (PubChem CID 91607334) has the molecular formula C43H36N2O7 and a molecular weight of 692.77 g/mol. Its IUPAC name is 5-O-[2-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]ethyl] 1-O-[4-(4-cyanophenyl)phenyl] 2-ethyl-4-methylpentanedioate.
| Compound Name | 5-O-[2-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]ethyl] 1-O-[4-(4-cyanophenyl)phenyl] 2-ethyl-4-methylpentanedioate |
|---|---|
| PubChem CID | 91607334 |
| Molecular Formula | C43H36N2O7 |
| Molecular Weight | 692.77 g/mol |
| Exact Mass | 692.25 |
| IUPAC Name | 5-O-[2-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]ethyl] 1-O-[4-(4-cyanophenyl)phenyl] 2-ethyl-4-methylpentanedioate |
| SMILES | CCC(CC(C)C(=O)OCCOc1ccc(C(=O)Oc2ccc(-c3ccc(C#N)cc3)cc2)cc1)C(=O)Oc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C43H36N2O7/c1-3-32(42(47)51-39-20-12-35(13-21-39)33-8-4-30(27-44)5-9-33)26-29(2)41(46)50-25-24-49-38-18-16-37(17-19-38)43(48)52-40-22-14-36(15-23-40)34-10-6-31(28-45)7-11-34/h4-23,29,32H,3,24-26H2,1-2H3 |
| InChIKey | RSIZXSYSOUXPOO-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 135.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.77 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|