C55H56O13 — CID 160882435
[4-(4-methoxyphenyl)phenyl] 4-[2-(2-methylbutanoyloxy)ethoxy]benzoate;methyl 4-[4-[4-[2-(2-methylbutanoyloxy)ethoxy]benzoyl]oxyphenyl]benzoate (PubChem CID 160882435) has the molecular formula C55H56O13 and a molecular weight of 925.04 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)phenyl] 4-[2-(2-methylbutanoyloxy)ethoxy]benzoate;methyl 4-[4-[4-[2-(2-methylbutanoyloxy)ethoxy]benzoyl]oxyphenyl]benzoate.
| Compound Name | [4-(4-methoxyphenyl)phenyl] 4-[2-(2-methylbutanoyloxy)ethoxy]benzoate;methyl 4-[4-[4-[2-(2-methylbutanoyloxy)ethoxy]benzoyl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 160882435 |
| Molecular Formula | C55H56O13 |
| Molecular Weight | 925.04 g/mol |
| Exact Mass | 924.37 |
| IUPAC Name | [4-(4-methoxyphenyl)phenyl] 4-[2-(2-methylbutanoyloxy)ethoxy]benzoate;methyl 4-[4-[4-[2-(2-methylbutanoyloxy)ethoxy]benzoyl]oxyphenyl]benzoate |
| SMILES | CCC(C)C(=O)OCCOc1ccc(C(=O)Oc2ccc(-c3ccc(C(=O)OC)cc3)cc2)cc1.CCC(C)C(=O)OCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H28O7.C27H28O6/c1-4-19(2)26(29)34-18-17-33-24-13-11-23(12-14-24)28(31)35-25-15-9-21(10-16-25)20-5-7-22(8-6-20)27(30)32-3;1-4-19(2)26(28)32-18-17-31-24-13-9-22(10-14-24)27(29)33-25-15-7-21(8-16-25)20-5-11-23(30-3)12-6-20/h5-16,19H,4,17-18H2,1-3H3;5-16,19H,4,17-18H2,1-3H3 |
| InChIKey | SNFAPUJHGICWMP-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.04 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|