C39H52O9 — CID 146200818
[4-(4-methoxyphenyl)phenyl] 4-[2-[2-[2-[2-(2-tert-butyl-4,4-dimethylpentanoyl)oxyethoxy]ethoxy]ethoxy]ethoxy]benzoate (PubChem CID 146200818) has the molecular formula C39H52O9 and a molecular weight of 664.84 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)phenyl] 4-[2-[2-[2-[2-(2-tert-butyl-4,4-dimethylpentanoyl)oxyethoxy]ethoxy]ethoxy]ethoxy]benzoate.
| Compound Name | [4-(4-methoxyphenyl)phenyl] 4-[2-[2-[2-[2-(2-tert-butyl-4,4-dimethylpentanoyl)oxyethoxy]ethoxy]ethoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 146200818 |
| Molecular Formula | C39H52O9 |
| Molecular Weight | 664.84 g/mol |
| Exact Mass | 664.36 |
| IUPAC Name | [4-(4-methoxyphenyl)phenyl] 4-[2-[2-[2-[2-(2-tert-butyl-4,4-dimethylpentanoyl)oxyethoxy]ethoxy]ethoxy]ethoxy]benzoate |
| SMILES | COc1ccc(-c2ccc(OC(=O)c3ccc(OCCOCCOCCOCCOC(=O)C(CC(C)(C)C)C(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H52O9/c1-38(2,3)28-35(39(4,5)6)37(41)47-27-25-45-23-21-43-20-22-44-24-26-46-33-16-12-31(13-17-33)36(40)48-34-18-10-30(11-19-34)29-8-14-32(42-7)15-9-29/h8-19,35H,20-28H2,1-7H3 |
| InChIKey | HQSZAFKTSXSZPX-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.84 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|