C44H58O10 — CID 170127656
[4-[4-(2-prop-2-enoyloxyethoxy)phenyl]phenyl] 4-[1-[1-[1-(2-tert-butyl-4,4-dimethylpentanoyl)oxypropan-2-yloxy]propan-2-yloxy]propan-2-yloxy]benzoate (PubChem CID 170127656) has the molecular formula C44H58O10 and a molecular weight of 746.94 g/mol. Its IUPAC name is [4-[4-(2-prop-2-enoyloxyethoxy)phenyl]phenyl] 4-[1-[1-[1-(2-tert-butyl-4,4-dimethylpentanoyl)oxypropan-2-yloxy]propan-2-yloxy]propan-2-yloxy]benzoate.
| Compound Name | [4-[4-(2-prop-2-enoyloxyethoxy)phenyl]phenyl] 4-[1-[1-[1-(2-tert-butyl-4,4-dimethylpentanoyl)oxypropan-2-yloxy]propan-2-yloxy]propan-2-yloxy]benzoate |
|---|---|
| PubChem CID | 170127656 |
| Molecular Formula | C44H58O10 |
| Molecular Weight | 746.94 g/mol |
| Exact Mass | 746.40 |
| IUPAC Name | [4-[4-(2-prop-2-enoyloxyethoxy)phenyl]phenyl] 4-[1-[1-[1-(2-tert-butyl-4,4-dimethylpentanoyl)oxypropan-2-yloxy]propan-2-yloxy]propan-2-yloxy]benzoate |
| SMILES | C=CC(=O)OCCOc1ccc(-c2ccc(OC(=O)c3ccc(OC(C)COC(C)COC(C)COC(=O)C(CC(C)(C)C)C(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C44H58O10/c1-11-40(45)49-25-24-48-36-18-12-33(13-19-36)34-14-20-38(21-15-34)54-41(46)35-16-22-37(23-17-35)53-32(4)29-51-30(2)27-50-31(3)28-52-42(47)39(44(8,9)10)26-43(5,6)7/h11-23,30-32,39H,1,24-29H2,2-10H3 |
| InChIKey | QIHBACADNUMJLH-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.94 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|