C30H36NO7P — CID 170127805
[4-[4-(methylamino)phenyl]phenyl] 4-[2-[2-[2-(2-phosphanylbutanoyloxy)ethoxy]ethoxy]ethoxy]benzoate (PubChem CID 170127805) has the molecular formula C30H36NO7P and a molecular weight of 553.59 g/mol. Its IUPAC name is [4-[4-(methylamino)phenyl]phenyl] 4-[2-[2-[2-(2-phosphanylbutanoyloxy)ethoxy]ethoxy]ethoxy]benzoate.
| Compound Name | [4-[4-(methylamino)phenyl]phenyl] 4-[2-[2-[2-(2-phosphanylbutanoyloxy)ethoxy]ethoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 170127805 |
| Molecular Formula | C30H36NO7P |
| Molecular Weight | 553.59 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | [4-[4-(methylamino)phenyl]phenyl] 4-[2-[2-[2-(2-phosphanylbutanoyloxy)ethoxy]ethoxy]ethoxy]benzoate |
| SMILES | CCC(P)C(=O)OCCOCCOCCOc1ccc(C(=O)Oc2ccc(-c3ccc(NC)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H36NO7P/c1-3-28(39)30(33)37-21-19-35-17-16-34-18-20-36-26-12-8-24(9-13-26)29(32)38-27-14-6-23(7-15-27)22-4-10-25(31-2)11-5-22/h4-15,28,31H,3,16-21,39H2,1-2H3 |
| InChIKey | KKLQLVXNHNKNLE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|