C32H34O11 — CID 171460630
4-[4-[4-[2-[2-[2-(2-methylbutanoyloxy)ethoxy]ethoxy]ethoxy]benzoyl]oxybenzoyl]oxybenzoic acid (PubChem CID 171460630) has the molecular formula C32H34O11 and a molecular weight of 594.61 g/mol. Its IUPAC name is 4-[4-[4-[2-[2-[2-(2-methylbutanoyloxy)ethoxy]ethoxy]ethoxy]benzoyl]oxybenzoyl]oxybenzoic acid.
| Compound Name | 4-[4-[4-[2-[2-[2-(2-methylbutanoyloxy)ethoxy]ethoxy]ethoxy]benzoyl]oxybenzoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 171460630 |
| Molecular Formula | C32H34O11 |
| Molecular Weight | 594.61 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | 4-[4-[4-[2-[2-[2-(2-methylbutanoyloxy)ethoxy]ethoxy]ethoxy]benzoyl]oxybenzoyl]oxybenzoic acid |
| SMILES | CCC(C)C(=O)OCCOCCOCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(C(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H34O11/c1-3-22(2)30(35)41-21-19-39-17-16-38-18-20-40-26-10-6-24(7-11-26)31(36)43-28-14-8-25(9-15-28)32(37)42-27-12-4-23(5-13-27)29(33)34/h4-15,22H,3,16-21H2,1-2H3,(H,33,34) |
| InChIKey | FATCMNOMYVWPDH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|