C34H37NO8 — CID 58957613
1-O-[2-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]ethyl] 5-O-(2-ethoxyethyl) 4-ethyl-2-methylpentanedioate (PubChem CID 58957613) has the molecular formula C34H37NO8 and a molecular weight of 587.67 g/mol. Its IUPAC name is 1-O-[2-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]ethyl] 5-O-(2-ethoxyethyl) 4-ethyl-2-methylpentanedioate.
| Compound Name | 1-O-[2-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]ethyl] 5-O-(2-ethoxyethyl) 4-ethyl-2-methylpentanedioate |
|---|---|
| PubChem CID | 58957613 |
| Molecular Formula | C34H37NO8 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | 1-O-[2-[4-[4-(4-cyanophenyl)phenoxy]carbonylphenoxy]ethyl] 5-O-(2-ethoxyethyl) 4-ethyl-2-methylpentanedioate |
| SMILES | CCOCCOC(=O)C(CC)CC(C)C(=O)OCCOc1ccc(C(=O)Oc2ccc(-c3ccc(C#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H37NO8/c1-4-26(33(37)42-19-18-39-5-2)22-24(3)32(36)41-21-20-40-30-14-12-29(13-15-30)34(38)43-31-16-10-28(11-17-31)27-8-6-25(23-35)7-9-27/h6-17,24,26H,4-5,18-22H2,1-3H3 |
| InChIKey | MFSCMLQBEANNRK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 121.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|