C31H33NO8 — CID 155634847
[4-(4-isocyanatophenyl)phenyl] 4-[2-[2-[2-(2-methylbutanoyloxy)ethoxy]ethoxy]ethoxy]benzoate (PubChem CID 155634847) has the molecular formula C31H33NO8 and a molecular weight of 547.60 g/mol. Its IUPAC name is [4-(4-isocyanatophenyl)phenyl] 4-[2-[2-[2-(2-methylbutanoyloxy)ethoxy]ethoxy]ethoxy]benzoate.
| Compound Name | [4-(4-isocyanatophenyl)phenyl] 4-[2-[2-[2-(2-methylbutanoyloxy)ethoxy]ethoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 155634847 |
| Molecular Formula | C31H33NO8 |
| Molecular Weight | 547.60 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | [4-(4-isocyanatophenyl)phenyl] 4-[2-[2-[2-(2-methylbutanoyloxy)ethoxy]ethoxy]ethoxy]benzoate |
| SMILES | CCC(C)C(=O)OCCOCCOCCOc1ccc(C(=O)Oc2ccc(-c3ccc(N=C=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H33NO8/c1-3-23(2)30(34)39-21-19-37-17-16-36-18-20-38-28-12-8-26(9-13-28)31(35)40-29-14-6-25(7-15-29)24-4-10-27(11-5-24)32-22-33/h4-15,23H,3,16-21H2,1-2H3 |
| InChIKey | VBAIDZKOYKZUQW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|