C30H32O7 — CID 168747448
[4-(4-methylphenoxy)carbonylphenyl] 4-[4-(2-methylbutanoyloxy)butoxy]benzoate (PubChem CID 168747448) has the molecular formula C30H32O7 and a molecular weight of 504.58 g/mol. Its IUPAC name is [4-(4-methylphenoxy)carbonylphenyl] 4-[4-(2-methylbutanoyloxy)butoxy]benzoate.
| Compound Name | [4-(4-methylphenoxy)carbonylphenyl] 4-[4-(2-methylbutanoyloxy)butoxy]benzoate |
|---|---|
| PubChem CID | 168747448 |
| Molecular Formula | C30H32O7 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | [4-(4-methylphenoxy)carbonylphenyl] 4-[4-(2-methylbutanoyloxy)butoxy]benzoate |
| SMILES | CCC(C)C(=O)OCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H32O7/c1-4-22(3)28(31)35-20-6-5-19-34-25-15-9-23(10-16-25)29(32)37-27-17-11-24(12-18-27)30(33)36-26-13-7-21(2)8-14-26/h7-18,22H,4-6,19-20H2,1-3H3 |
| InChIKey | HYSKJHYYAPQDQU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|