C31H36O6 — CID 153445029
[4-(4-methoxyphenyl)phenyl] 4-[6-(2-methylbutanoyloxy)hexoxy]benzoate (PubChem CID 153445029) has the molecular formula C31H36O6 and a molecular weight of 504.62 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)phenyl] 4-[6-(2-methylbutanoyloxy)hexoxy]benzoate.
| Compound Name | [4-(4-methoxyphenyl)phenyl] 4-[6-(2-methylbutanoyloxy)hexoxy]benzoate |
|---|---|
| PubChem CID | 153445029 |
| Molecular Formula | C31H36O6 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | [4-(4-methoxyphenyl)phenyl] 4-[6-(2-methylbutanoyloxy)hexoxy]benzoate |
| SMILES | CCC(C)C(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H36O6/c1-4-23(2)30(32)36-22-8-6-5-7-21-35-28-17-13-26(14-18-28)31(33)37-29-19-11-25(12-20-29)24-9-15-27(34-3)16-10-24/h9-20,23H,4-8,21-22H2,1-3H3 |
| InChIKey | HFQHRCGWJGWGNG-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|