About [4-(2-methylbutanoyloxy)phenyl] 4-nonoxybenzoate
[4-(2-methylbutanoyloxy)phenyl] 4-nonoxybenzoate (PubChem CID 70404404) has the molecular formula C27H36O5
and a molecular weight of 440.58 g/mol. Its IUPAC name is [4-(2-methylbutanoyloxy)phenyl] 4-nonoxybenzoate.
Molecular Properties
| Compound Name | [4-(2-methylbutanoyloxy)phenyl] 4-nonoxybenzoate |
| PubChem CID | 70404404 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | [4-(2-methylbutanoyloxy)phenyl] 4-nonoxybenzoate |
| SMILES | CCCCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)C(C)CC)cc2)cc1 |
| InChI | InChI=1S/C27H36O5/c1-4-6-7-8-9-10-11-20-30-23-14-12-22(13-15-23)27(29)32-25-18-16-24(17-19-25)31-26(28)21(3)5-2/h12-19,21H,4-11,20H2,1-3H3 |
| InChIKey | SHIPCMZKSDBUGL-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-methylbutanoyloxy)phenyl] 4-nonoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-methylbutanoyloxy)phenyl] 4-nonoxybenzoate?
The IUPAC name of [4-(2-methylbutanoyloxy)phenyl] 4-nonoxybenzoate (CID 70404404) is [4-(2-methylbutanoyloxy)phenyl] 4-nonoxybenzoate.
What is the SMILES notation for [4-(2-methylbutanoyloxy)phenyl] 4-nonoxybenzoate?
The canonical SMILES for [4-(2-methylbutanoyloxy)phenyl] 4-nonoxybenzoate is CCCCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)C(C)CC)cc2)cc1.
What is the InChIKey of [4-(2-methylbutanoyloxy)phenyl] 4-nonoxybenzoate?
The InChIKey is SHIPCMZKSDBUGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H36O5/c1-4-6-7-8-9-10-11-20-30-23-14-12-22(13-15-23)27(29)32-25-18-16-24(17-19-25)31-26(28)21(3)5-2/h12-19,21H,4-11,20H2,1-3H3.
What are the key properties of [4-(2-methylbutanoyloxy)phenyl] 4-nonoxybenzoate?
[4-(2-methylbutanoyloxy)phenyl] 4-nonoxybenzoate has a molecular weight of 440.58 g/mol, XLogP of 6.99, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-methylbutanoyloxy)phenyl] 4-nonoxybenzoate is sourced from PubChem (CID 70404404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).