About [4-(4-propan-2-yloxycarbonylphenoxy)carbonylphenyl] 4-octoxybenzoate
[4-(4-propan-2-yloxycarbonylphenoxy)carbonylphenyl] 4-octoxybenzoate (PubChem CID 101077333) has the molecular formula C32H36O7
and a molecular weight of 532.63 g/mol. Its IUPAC name is [4-(4-propan-2-yloxycarbonylphenoxy)carbonylphenyl] 4-octoxybenzoate.
Molecular Properties
| Compound Name | [4-(4-propan-2-yloxycarbonylphenoxy)carbonylphenyl] 4-octoxybenzoate |
| PubChem CID | 101077333 |
| Molecular Formula | C32H36O7 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | [4-(4-propan-2-yloxycarbonylphenoxy)carbonylphenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(C(=O)OC(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H36O7/c1-4-5-6-7-8-9-22-36-27-16-10-25(11-17-27)31(34)38-29-20-14-26(15-21-29)32(35)39-28-18-12-24(13-19-28)30(33)37-23(2)3/h10-21,23H,4-9,22H2,1-3H3 |
| InChIKey | ICIHZCALUPVGKV-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-propan-2-yloxycarbonylphenoxy)carbonylphenyl] 4-octoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-propan-2-yloxycarbonylphenoxy)carbonylphenyl] 4-octoxybenzoate?
The IUPAC name of [4-(4-propan-2-yloxycarbonylphenoxy)carbonylphenyl] 4-octoxybenzoate (CID 101077333) is [4-(4-propan-2-yloxycarbonylphenoxy)carbonylphenyl] 4-octoxybenzoate.
What is the SMILES notation for [4-(4-propan-2-yloxycarbonylphenoxy)carbonylphenyl] 4-octoxybenzoate?
The canonical SMILES for [4-(4-propan-2-yloxycarbonylphenoxy)carbonylphenyl] 4-octoxybenzoate is CCCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(C(=O)OC(C)C)cc3)cc2)cc1.
What is the InChIKey of [4-(4-propan-2-yloxycarbonylphenoxy)carbonylphenyl] 4-octoxybenzoate?
The InChIKey is ICIHZCALUPVGKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H36O7/c1-4-5-6-7-8-9-22-36-27-16-10-25(11-17-27)31(34)38-29-20-14-26(15-21-29)32(35)39-28-18-12-24(13-19-28)30(33)37-23(2)3/h10-21,23H,4-9,22H2,1-3H3.
What are the key properties of [4-(4-propan-2-yloxycarbonylphenoxy)carbonylphenyl] 4-octoxybenzoate?
[4-(4-propan-2-yloxycarbonylphenoxy)carbonylphenyl] 4-octoxybenzoate has a molecular weight of 532.63 g/mol, XLogP of 7.43, 14 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-propan-2-yloxycarbonylphenoxy)carbonylphenyl] 4-octoxybenzoate is sourced from PubChem (CID 101077333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).