About (4-hexoxyphenyl) 4-aminobenzoate
(4-hexoxyphenyl) 4-aminobenzoate (PubChem CID 54274650) has the molecular formula C19H23NO3
and a molecular weight of 313.40 g/mol. Its IUPAC name is (4-hexoxyphenyl) 4-aminobenzoate.
Molecular Properties
| Compound Name | (4-hexoxyphenyl) 4-aminobenzoate |
| PubChem CID | 54274650 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (4-hexoxyphenyl) 4-aminobenzoate |
| SMILES | CCCCCCOc1ccc(OC(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C19H23NO3/c1-2-3-4-5-14-22-17-10-12-18(13-11-17)23-19(21)15-6-8-16(20)9-7-15/h6-13H,2-5,14,20H2,1H3 |
| InChIKey | RMONMWJPAMPMGQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-hexoxyphenyl) 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hexoxyphenyl) 4-aminobenzoate?
The IUPAC name of (4-hexoxyphenyl) 4-aminobenzoate (CID 54274650) is (4-hexoxyphenyl) 4-aminobenzoate.
What is the SMILES notation for (4-hexoxyphenyl) 4-aminobenzoate?
The canonical SMILES for (4-hexoxyphenyl) 4-aminobenzoate is CCCCCCOc1ccc(OC(=O)c2ccc(N)cc2)cc1.
What is the InChIKey of (4-hexoxyphenyl) 4-aminobenzoate?
The InChIKey is RMONMWJPAMPMGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO3/c1-2-3-4-5-14-22-17-10-12-18(13-11-17)23-19(21)15-6-8-16(20)9-7-15/h6-13H,2-5,14,20H2,1H3.
What are the key properties of (4-hexoxyphenyl) 4-aminobenzoate?
(4-hexoxyphenyl) 4-aminobenzoate has a molecular weight of 313.40 g/mol, XLogP of 4.45, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hexoxyphenyl) 4-aminobenzoate is sourced from PubChem (CID 54274650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).