C50H70O10 — CID 135126936
[4-[4-[4-(2-tert-butyl-4,4-dimethylpentanoyl)oxybutoxy]benzoyl]oxy-3-methylphenyl] 4-[4-(2-tert-butyl-4-methylpentanoyl)oxybutoxy]benzoate (PubChem CID 135126936) has the molecular formula C50H70O10 and a molecular weight of 831.10 g/mol. Its IUPAC name is [4-[4-[4-(2-tert-butyl-4,4-dimethylpentanoyl)oxybutoxy]benzoyl]oxy-3-methylphenyl] 4-[4-(2-tert-butyl-4-methylpentanoyl)oxybutoxy]benzoate.
| Compound Name | [4-[4-[4-(2-tert-butyl-4,4-dimethylpentanoyl)oxybutoxy]benzoyl]oxy-3-methylphenyl] 4-[4-(2-tert-butyl-4-methylpentanoyl)oxybutoxy]benzoate |
|---|---|
| PubChem CID | 135126936 |
| Molecular Formula | C50H70O10 |
| Molecular Weight | 831.10 g/mol |
| Exact Mass | 830.50 |
| IUPAC Name | [4-[4-[4-(2-tert-butyl-4,4-dimethylpentanoyl)oxybutoxy]benzoyl]oxy-3-methylphenyl] 4-[4-(2-tert-butyl-4-methylpentanoyl)oxybutoxy]benzoate |
| SMILES | Cc1cc(OC(=O)c2ccc(OCCCCOC(=O)C(CC(C)C)C(C)(C)C)cc2)ccc1OC(=O)c1ccc(OCCCCOC(=O)C(CC(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C50H70O10/c1-34(2)31-41(49(7,8)9)46(53)57-29-15-13-27-55-38-21-17-36(18-22-38)44(51)59-40-25-26-43(35(3)32-40)60-45(52)37-19-23-39(24-20-37)56-28-14-16-30-58-47(54)42(50(10,11)12)33-48(4,5)6/h17-26,32,34,41-42H,13-16,27-31,33H2,1-12H3 |
| InChIKey | NYTUPQZGUSAQHR-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.10 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|