C31H43BO7 — CID 145429776
[4-(1,3,2-dioxaborinan-2-yl)phenyl] 4-[4-(2-tert-butyl-4-methylpentanoyl)oxybutoxy]-3-methylbenzoate (PubChem CID 145429776) has the molecular formula C31H43BO7 and a molecular weight of 538.49 g/mol. Its IUPAC name is [4-(1,3,2-dioxaborinan-2-yl)phenyl] 4-[4-(2-tert-butyl-4-methylpentanoyl)oxybutoxy]-3-methylbenzoate.
| Compound Name | [4-(1,3,2-dioxaborinan-2-yl)phenyl] 4-[4-(2-tert-butyl-4-methylpentanoyl)oxybutoxy]-3-methylbenzoate |
|---|---|
| PubChem CID | 145429776 |
| Molecular Formula | C31H43BO7 |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | [4-(1,3,2-dioxaborinan-2-yl)phenyl] 4-[4-(2-tert-butyl-4-methylpentanoyl)oxybutoxy]-3-methylbenzoate |
| SMILES | Cc1cc(C(=O)Oc2ccc(B3OCCCO3)cc2)ccc1OCCCCOC(=O)C(CC(C)C)C(C)(C)C |
| InChI | InChI=1S/C31H43BO7/c1-22(2)20-27(31(4,5)6)30(34)36-17-8-7-16-35-28-15-10-24(21-23(28)3)29(33)39-26-13-11-25(12-14-26)32-37-18-9-19-38-32/h10-15,21-22,27H,7-9,16-20H2,1-6H3 |
| InChIKey | KQNYOVHBEHGXGV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|