C33H36O7 — CID 90265947
[4-(4-butylphenoxy)carbonylphenyl] 3-methyl-4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate (PubChem CID 90265947) has the molecular formula C33H36O7 and a molecular weight of 544.64 g/mol. Its IUPAC name is [4-(4-butylphenoxy)carbonylphenyl] 3-methyl-4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate.
| Compound Name | [4-(4-butylphenoxy)carbonylphenyl] 3-methyl-4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate |
|---|---|
| PubChem CID | 90265947 |
| Molecular Formula | C33H36O7 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | [4-(4-butylphenoxy)carbonylphenyl] 3-methyl-4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(CCCC)cc3)cc2)cc1C |
| InChI | InChI=1S/C33H36O7/c1-5-6-9-25-10-15-28(16-11-25)39-32(35)26-12-17-29(18-13-26)40-33(36)27-14-19-30(24(4)22-27)37-20-7-8-21-38-31(34)23(2)3/h10-19,22H,2,5-9,20-21H2,1,3-4H3 |
| InChIKey | AAMBKNSQIHSJSD-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|