C33H46O6 — CID 102272400
[4-[10-(2-methylprop-2-enoyloxy)decoxy]phenyl] 4-hexoxybenzoate (PubChem CID 102272400) has the molecular formula C33H46O6 and a molecular weight of 538.73 g/mol. Its IUPAC name is [4-[10-(2-methylprop-2-enoyloxy)decoxy]phenyl] 4-hexoxybenzoate.
| Compound Name | [4-[10-(2-methylprop-2-enoyloxy)decoxy]phenyl] 4-hexoxybenzoate |
|---|---|
| PubChem CID | 102272400 |
| Molecular Formula | C33H46O6 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | [4-[10-(2-methylprop-2-enoyloxy)decoxy]phenyl] 4-hexoxybenzoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCOc1ccc(OC(=O)c2ccc(OCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C33H46O6/c1-4-5-6-13-24-36-29-18-16-28(17-19-29)33(35)39-31-22-20-30(21-23-31)37-25-14-11-9-7-8-10-12-15-26-38-32(34)27(2)3/h16-23H,2,4-15,24-26H2,1,3H3 |
| InChIKey | UQYWXGMABOFRFC-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|