C33H38O8 — CID 170546232
[4-[(4-hexoxyphenoxy)methoxy]-2-methylphenyl] 4-[2-(2-methylprop-2-enoyloxy)ethoxy]benzoate (PubChem CID 170546232) has the molecular formula C33H38O8 and a molecular weight of 562.66 g/mol. Its IUPAC name is [4-[(4-hexoxyphenoxy)methoxy]-2-methylphenyl] 4-[2-(2-methylprop-2-enoyloxy)ethoxy]benzoate.
| Compound Name | [4-[(4-hexoxyphenoxy)methoxy]-2-methylphenyl] 4-[2-(2-methylprop-2-enoyloxy)ethoxy]benzoate |
|---|---|
| PubChem CID | 170546232 |
| Molecular Formula | C33H38O8 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | [4-[(4-hexoxyphenoxy)methoxy]-2-methylphenyl] 4-[2-(2-methylprop-2-enoyloxy)ethoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C(=O)Oc2ccc(OCOc3ccc(OCCCCCC)cc3)cc2C)cc1 |
| InChI | InChI=1S/C33H38O8/c1-5-6-7-8-19-36-28-13-15-29(16-14-28)39-23-40-30-17-18-31(25(4)22-30)41-33(35)26-9-11-27(12-10-26)37-20-21-38-32(34)24(2)3/h9-18,22H,2,5-8,19-21,23H2,1,3-4H3 |
| InChIKey | MVHDDOLENOBMSS-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|