C32H30O9 — CID 154625022
4-O-methyl 1-O-[2-methyl-4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]benzoyl]oxyphenyl] 2-methylidenebutanedioate (PubChem CID 154625022) has the molecular formula C32H30O9 and a molecular weight of 558.58 g/mol. Its IUPAC name is 4-O-methyl 1-O-[2-methyl-4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]benzoyl]oxyphenyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-methyl 1-O-[2-methyl-4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]benzoyl]oxyphenyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154625022 |
| Molecular Formula | C32H30O9 |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 4-O-methyl 1-O-[2-methyl-4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]benzoyl]oxyphenyl] 2-methylidenebutanedioate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(-c2ccc(C(=O)Oc3ccc(OC(=O)C(=C)CC(=O)OC)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C32H30O9/c1-20(2)30(34)39-17-16-38-26-12-10-24(11-13-26)23-6-8-25(9-7-23)32(36)40-27-14-15-28(21(3)18-27)41-31(35)22(4)19-29(33)37-5/h6-15,18H,1,4,16-17,19H2,2-3,5H3 |
| InChIKey | VVAMZTJTYHQSPU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|