C24H21FO9 — CID 139409188
1-O-[4-[4-[2-(2-fluoroprop-2-enoyloxy)ethoxy]benzoyl]oxyphenyl] 4-O-methyl 2-methylidenebutanedioate (PubChem CID 139409188) has the molecular formula C24H21FO9 and a molecular weight of 472.42 g/mol. Its IUPAC name is 1-O-[4-[4-[2-(2-fluoroprop-2-enoyloxy)ethoxy]benzoyl]oxyphenyl] 4-O-methyl 2-methylidenebutanedioate.
| Compound Name | 1-O-[4-[4-[2-(2-fluoroprop-2-enoyloxy)ethoxy]benzoyl]oxyphenyl] 4-O-methyl 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 139409188 |
| Molecular Formula | C24H21FO9 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 1-O-[4-[4-[2-(2-fluoroprop-2-enoyloxy)ethoxy]benzoyl]oxyphenyl] 4-O-methyl 2-methylidenebutanedioate |
| SMILES | C=C(F)C(=O)OCCOc1ccc(C(=O)Oc2ccc(OC(=O)C(=C)CC(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C24H21FO9/c1-15(14-21(26)30-3)22(27)33-19-8-10-20(11-9-19)34-24(29)17-4-6-18(7-5-17)31-12-13-32-23(28)16(2)25/h4-11H,1-2,12-14H2,3H3 |
| InChIKey | RMDJQSUUEXAVRP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|