C32H31FO10 — CID 58895419
2-(2-fluoroprop-2-enoyloxy)ethyl 2-propoxy-5-[4-(4-propoxybenzoyl)oxybenzoyl]oxybenzoate (PubChem CID 58895419) has the molecular formula C32H31FO10 and a molecular weight of 594.59 g/mol. Its IUPAC name is 2-(2-fluoroprop-2-enoyloxy)ethyl 2-propoxy-5-[4-(4-propoxybenzoyl)oxybenzoyl]oxybenzoate.
| Compound Name | 2-(2-fluoroprop-2-enoyloxy)ethyl 2-propoxy-5-[4-(4-propoxybenzoyl)oxybenzoyl]oxybenzoate |
|---|---|
| PubChem CID | 58895419 |
| Molecular Formula | C32H31FO10 |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | 2-(2-fluoroprop-2-enoyloxy)ethyl 2-propoxy-5-[4-(4-propoxybenzoyl)oxybenzoyl]oxybenzoate |
| SMILES | C=C(F)C(=O)OCCOC(=O)c1cc(OC(=O)c2ccc(OC(=O)c3ccc(OCCC)cc3)cc2)ccc1OCCC |
| InChI | InChI=1S/C32H31FO10/c1-4-16-38-24-10-6-22(7-11-24)30(35)42-25-12-8-23(9-13-25)31(36)43-26-14-15-28(39-17-5-2)27(20-26)32(37)41-19-18-40-29(34)21(3)33/h6-15,20H,3-5,16-19H2,1-2H3 |
| InChIKey | ADJQQZTXNXDFKN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|