C26H29FO7 — CID 58307803
3-O-[4-(2-fluoroprop-2-enoyloxy)butyl] 1-O-(4-methylphenyl) 4-butoxybenzene-1,3-dicarboxylate (PubChem CID 58307803) has the molecular formula C26H29FO7 and a molecular weight of 472.51 g/mol. Its IUPAC name is 3-O-[4-(2-fluoroprop-2-enoyloxy)butyl] 1-O-(4-methylphenyl) 4-butoxybenzene-1,3-dicarboxylate.
| Compound Name | 3-O-[4-(2-fluoroprop-2-enoyloxy)butyl] 1-O-(4-methylphenyl) 4-butoxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 58307803 |
| Molecular Formula | C26H29FO7 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 3-O-[4-(2-fluoroprop-2-enoyloxy)butyl] 1-O-(4-methylphenyl) 4-butoxybenzene-1,3-dicarboxylate |
| SMILES | C=C(F)C(=O)OCCCCOC(=O)c1cc(C(=O)Oc2ccc(C)cc2)ccc1OCCCC |
| InChI | InChI=1S/C26H29FO7/c1-4-5-14-31-23-13-10-20(25(29)34-21-11-8-18(2)9-12-21)17-22(23)26(30)33-16-7-6-15-32-24(28)19(3)27/h8-13,17H,3-7,14-16H2,1-2H3 |
| InChIKey | IVTMIUBMBZGMPR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|