(4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate

C26H24O5 — CID 58757911

IUPAC(4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate
SMILESCCCCOC(=O)c1ccc(OC(=O)c2ccc(C(=O)c3ccc(C)cc3)cc2)cc1
InChIInChI=1S/C26H24O5/c1-3-4-17-30-25(28)21-13-15-23(16-14-21)31-26(29)22-11-9-20(10-12-22)24(27)19-7-5-18(2)6-8-19/h5-16H,3-4,17H2,1-2H3
InChIKeyTWKFTSHHWKPHSS-UHFFFAOYSA-N
MW416.47 g/mol
LogP5.40
Rot. Bonds8

About (4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate

(4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate (PubChem CID 58757911) has the molecular formula C26H24O5 and a molecular weight of 416.47 g/mol. Its IUPAC name is (4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate.

Molecular Properties

Compound Name(4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate
PubChem CID58757911
Molecular FormulaC26H24O5
Molecular Weight416.47 g/mol
Exact Mass416.16
IUPAC Name(4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate
SMILESCCCCOC(=O)c1ccc(OC(=O)c2ccc(C(=O)c3ccc(C)cc3)cc2)cc1
InChIInChI=1S/C26H24O5/c1-3-4-17-30-25(28)21-13-15-23(16-14-21)31-26(29)22-11-9-20(10-12-22)24(27)19-7-5-18(2)6-8-19/h5-16H,3-4,17H2,1-2H3
InChIKeyTWKFTSHHWKPHSS-UHFFFAOYSA-N
XLogP5.40
TPSA69.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms31
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500416.47
LogP ≤ 55.40
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate?
The IUPAC name of (4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate (CID 58757911) is (4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate.
What is the SMILES notation for (4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate?
The canonical SMILES for (4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate is CCCCOC(=O)c1ccc(OC(=O)c2ccc(C(=O)c3ccc(C)cc3)cc2)cc1.
What is the InChIKey of (4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate?
The InChIKey is TWKFTSHHWKPHSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24O5/c1-3-4-17-30-25(28)21-13-15-23(16-14-21)31-26(29)22-11-9-20(10-12-22)24(27)19-7-5-18(2)6-8-19/h5-16H,3-4,17H2,1-2H3.
What are the key properties of (4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate?
(4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate has a molecular weight of 416.47 g/mol, XLogP of 5.40, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butoxycarbonylphenyl) 4-(4-methylbenzoyl)benzoate is sourced from PubChem (CID 58757911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).