C21H24O4 — CID 91735468
4-O-(3,5-dimethylphenyl) 1-O-pentyl benzene-1,4-dicarboxylate (PubChem CID 91735468) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 4-O-(3,5-dimethylphenyl) 1-O-pentyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-(3,5-dimethylphenyl) 1-O-pentyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91735468 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-O-(3,5-dimethylphenyl) 1-O-pentyl benzene-1,4-dicarboxylate |
| SMILES | CCCCCOC(=O)c1ccc(C(=O)Oc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C21H24O4/c1-4-5-6-11-24-20(22)17-7-9-18(10-8-17)21(23)25-19-13-15(2)12-16(3)14-19/h7-10,12-14H,4-6,11H2,1-3H3 |
| InChIKey | BVXVUNGPISHGAV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|