C22H26O4 — CID 91736924
4-O-(3,5-dimethylphenyl) 1-O-hexyl benzene-1,4-dicarboxylate (PubChem CID 91736924) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-O-(3,5-dimethylphenyl) 1-O-hexyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-(3,5-dimethylphenyl) 1-O-hexyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91736924 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-O-(3,5-dimethylphenyl) 1-O-hexyl benzene-1,4-dicarboxylate |
| SMILES | CCCCCCOC(=O)c1ccc(C(=O)Oc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C22H26O4/c1-4-5-6-7-12-25-21(23)18-8-10-19(11-9-18)22(24)26-20-14-16(2)13-17(3)15-20/h8-11,13-15H,4-7,12H2,1-3H3 |
| InChIKey | RRATTZURCYOFLV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|