C26H27F3O7 — CID 58307816
1-O-(4-methylphenyl) 3-O-[2-[2-(trifluoromethyl)prop-2-enoyloxy]ethyl] 4-pentoxybenzene-1,3-dicarboxylate (PubChem CID 58307816) has the molecular formula C26H27F3O7 and a molecular weight of 508.49 g/mol. Its IUPAC name is 1-O-(4-methylphenyl) 3-O-[2-[2-(trifluoromethyl)prop-2-enoyloxy]ethyl] 4-pentoxybenzene-1,3-dicarboxylate.
| Compound Name | 1-O-(4-methylphenyl) 3-O-[2-[2-(trifluoromethyl)prop-2-enoyloxy]ethyl] 4-pentoxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 58307816 |
| Molecular Formula | C26H27F3O7 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 1-O-(4-methylphenyl) 3-O-[2-[2-(trifluoromethyl)prop-2-enoyloxy]ethyl] 4-pentoxybenzene-1,3-dicarboxylate |
| SMILES | C=C(C(=O)OCCOC(=O)c1cc(C(=O)Oc2ccc(C)cc2)ccc1OCCCCC)C(F)(F)F |
| InChI | InChI=1S/C26H27F3O7/c1-4-5-6-13-33-22-12-9-19(24(31)36-20-10-7-17(2)8-11-20)16-21(22)25(32)35-15-14-34-23(30)18(3)26(27,28)29/h7-12,16H,3-6,13-15H2,1-2H3 |
| InChIKey | XSESLRHUXWCHIZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|