C32H31FO7 — CID 139409087
[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 4-[6-(2-fluoroprop-2-enoyloxy)hexoxy]benzoate (PubChem CID 139409087) has the molecular formula C32H31FO7 and a molecular weight of 546.59 g/mol. Its IUPAC name is [4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 4-[6-(2-fluoroprop-2-enoyloxy)hexoxy]benzoate.
| Compound Name | [4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 4-[6-(2-fluoroprop-2-enoyloxy)hexoxy]benzoate |
|---|---|
| PubChem CID | 139409087 |
| Molecular Formula | C32H31FO7 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | [4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 4-[6-(2-fluoroprop-2-enoyloxy)hexoxy]benzoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OC(=O)c3ccc(OCCCCCCOC(=O)C(=C)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H31FO7/c1-22(2)30(34)39-28-16-8-24(9-17-28)25-10-18-29(19-11-25)40-32(36)26-12-14-27(15-13-26)37-20-6-4-5-7-21-38-31(35)23(3)33/h8-19H,1,3-7,20-21H2,2H3 |
| InChIKey | CFHNYCYDYPZCDF-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|