C35H29FO8 — CID 139409121
[4-[4-[4-[2-(hydroxymethyl)prop-2-enoyloxy]phenyl]phenyl]phenyl] 4-[3-(2-fluoroprop-2-enoyloxy)propoxy]benzoate (PubChem CID 139409121) has the molecular formula C35H29FO8 and a molecular weight of 596.61 g/mol. Its IUPAC name is [4-[4-[4-[2-(hydroxymethyl)prop-2-enoyloxy]phenyl]phenyl]phenyl] 4-[3-(2-fluoroprop-2-enoyloxy)propoxy]benzoate.
| Compound Name | [4-[4-[4-[2-(hydroxymethyl)prop-2-enoyloxy]phenyl]phenyl]phenyl] 4-[3-(2-fluoroprop-2-enoyloxy)propoxy]benzoate |
|---|---|
| PubChem CID | 139409121 |
| Molecular Formula | C35H29FO8 |
| Molecular Weight | 596.61 g/mol |
| Exact Mass | 596.18 |
| IUPAC Name | [4-[4-[4-[2-(hydroxymethyl)prop-2-enoyloxy]phenyl]phenyl]phenyl] 4-[3-(2-fluoroprop-2-enoyloxy)propoxy]benzoate |
| SMILES | C=C(F)C(=O)OCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(-c4ccc(OC(=O)C(=C)CO)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H29FO8/c1-23(22-37)33(38)43-31-16-8-27(9-17-31)25-4-6-26(7-5-25)28-10-18-32(19-11-28)44-35(40)29-12-14-30(15-13-29)41-20-3-21-42-34(39)24(2)36/h4-19,37H,1-3,20-22H2 |
| InChIKey | ZQWIMEVKLGLTRC-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.61 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|