C29H24F2O7S — CID 155241468
3-[2-fluoro-4-[4-[4-(2-fluoroprop-2-enoyloxy)phenyl]sulfanylcarbonylphenyl]phenoxy]propyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 155241468) has the molecular formula C29H24F2O7S and a molecular weight of 554.57 g/mol. Its IUPAC name is 3-[2-fluoro-4-[4-[4-(2-fluoroprop-2-enoyloxy)phenyl]sulfanylcarbonylphenyl]phenoxy]propyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 3-[2-fluoro-4-[4-[4-(2-fluoroprop-2-enoyloxy)phenyl]sulfanylcarbonylphenyl]phenoxy]propyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 155241468 |
| Molecular Formula | C29H24F2O7S |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | 3-[2-fluoro-4-[4-[4-(2-fluoroprop-2-enoyloxy)phenyl]sulfanylcarbonylphenyl]phenoxy]propyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(F)C(=O)Oc1ccc(SC(=O)c2ccc(-c3ccc(OCCCOC(=O)C(=C)CO)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C29H24F2O7S/c1-18(17-32)27(33)37-15-3-14-36-26-13-8-22(16-25(26)31)20-4-6-21(7-5-20)29(35)39-24-11-9-23(10-12-24)38-28(34)19(2)30/h4-13,16,32H,1-3,14-15,17H2 |
| InChIKey | QNGNPBGAFFBCOR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|