C42H32FNO7S — CID 155241974
3-[4-[4-[2-[4-[2-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]ethynyl]phenyl]ethynyl]benzoyl]sulfanylphenoxy]propyl 2-fluoroprop-2-enoate (PubChem CID 155241974) has the molecular formula C42H32FNO7S and a molecular weight of 713.78 g/mol. Its IUPAC name is 3-[4-[4-[2-[4-[2-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]ethynyl]phenyl]ethynyl]benzoyl]sulfanylphenoxy]propyl 2-fluoroprop-2-enoate.
| Compound Name | 3-[4-[4-[2-[4-[2-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]ethynyl]phenyl]ethynyl]benzoyl]sulfanylphenoxy]propyl 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 155241974 |
| Molecular Formula | C42H32FNO7S |
| Molecular Weight | 713.78 g/mol |
| Exact Mass | 713.19 |
| IUPAC Name | 3-[4-[4-[2-[4-[2-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]ethynyl]phenyl]ethynyl]benzoyl]sulfanylphenoxy]propyl 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)OCCCOc1ccc(SC(=O)c2ccc(C#Cc3ccc(C#Cc4ccc(OCCCN5C(=O)C=CC5=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H32FNO7S/c1-30(43)41(47)51-29-3-28-50-37-20-22-38(23-21-37)52-42(48)35-16-12-33(13-17-35)10-8-31-4-6-32(7-5-31)9-11-34-14-18-36(19-15-34)49-27-2-26-44-39(45)24-25-40(44)46/h4-7,12-25H,1-3,26-29H2 |
| InChIKey | IGOFOXPRPXFLFV-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.78 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|