C42H33NO7S — CID 155241629
ethenyl 2-[4-[4-[2-[4-[2-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]ethynyl]phenyl]ethynyl]phenyl]sulfanylcarbonyl-2-ethylphenoxy]acetate (PubChem CID 155241629) has the molecular formula C42H33NO7S and a molecular weight of 695.79 g/mol. Its IUPAC name is ethenyl 2-[4-[4-[2-[4-[2-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]ethynyl]phenyl]ethynyl]phenyl]sulfanylcarbonyl-2-ethylphenoxy]acetate.
| Compound Name | ethenyl 2-[4-[4-[2-[4-[2-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]ethynyl]phenyl]ethynyl]phenyl]sulfanylcarbonyl-2-ethylphenoxy]acetate |
|---|---|
| PubChem CID | 155241629 |
| Molecular Formula | C42H33NO7S |
| Molecular Weight | 695.79 g/mol |
| Exact Mass | 695.20 |
| IUPAC Name | ethenyl 2-[4-[4-[2-[4-[2-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]ethynyl]phenyl]ethynyl]phenyl]sulfanylcarbonyl-2-ethylphenoxy]acetate |
| SMILES | C=COC(=O)COc1ccc(C(=O)Sc2ccc(C#Cc3ccc(C#Cc4ccc(OCCCN5C(=O)C=CC5=O)cc4)cc3)cc2)cc1CC |
| InChI | InChI=1S/C42H33NO7S/c1-3-34-28-35(18-23-38(34)50-29-41(46)48-4-2)42(47)51-37-21-16-33(17-22-37)13-11-31-8-6-30(7-9-31)10-12-32-14-19-36(20-15-32)49-27-5-26-43-39(44)24-25-40(43)45/h4,6-9,14-25,28H,2-3,5,26-27,29H2,1H3 |
| InChIKey | RHSZKHUWLWRWNY-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.79 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|