About S-(4-methylphenyl) 4-hexoxybenzenecarbothioate
S-(4-methylphenyl) 4-hexoxybenzenecarbothioate (PubChem CID 71385543) has the molecular formula C20H24O2S
and a molecular weight of 328.48 g/mol. Its IUPAC name is S-(4-methylphenyl) 4-hexoxybenzenecarbothioate.
Molecular Properties
| Compound Name | S-(4-methylphenyl) 4-hexoxybenzenecarbothioate |
| PubChem CID | 71385543 |
| Molecular Formula | C20H24O2S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | S-(4-methylphenyl) 4-hexoxybenzenecarbothioate |
| SMILES | CCCCCCOc1ccc(C(=O)Sc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H24O2S/c1-3-4-5-6-15-22-18-11-9-17(10-12-18)20(21)23-19-13-7-16(2)8-14-19/h7-14H,3-6,15H2,1-2H3 |
| InChIKey | TZAYNNKMXKKORC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methylphenyl) 4-hexoxybenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methylphenyl) 4-hexoxybenzenecarbothioate?
The IUPAC name of S-(4-methylphenyl) 4-hexoxybenzenecarbothioate (CID 71385543) is S-(4-methylphenyl) 4-hexoxybenzenecarbothioate.
What is the SMILES notation for S-(4-methylphenyl) 4-hexoxybenzenecarbothioate?
The canonical SMILES for S-(4-methylphenyl) 4-hexoxybenzenecarbothioate is CCCCCCOc1ccc(C(=O)Sc2ccc(C)cc2)cc1.
What is the InChIKey of S-(4-methylphenyl) 4-hexoxybenzenecarbothioate?
The InChIKey is TZAYNNKMXKKORC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O2S/c1-3-4-5-6-15-22-18-11-9-17(10-12-18)20(21)23-19-13-7-16(2)8-14-19/h7-14H,3-6,15H2,1-2H3.
What are the key properties of S-(4-methylphenyl) 4-hexoxybenzenecarbothioate?
S-(4-methylphenyl) 4-hexoxybenzenecarbothioate has a molecular weight of 328.48 g/mol, XLogP of 5.89, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methylphenyl) 4-hexoxybenzenecarbothioate is sourced from PubChem (CID 71385543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).