About S-(4-octoxyphenyl) 4-(2-fluorodecoxy)benzenecarbothioate
S-(4-octoxyphenyl) 4-(2-fluorodecoxy)benzenecarbothioate (PubChem CID 14297710) has the molecular formula C31H45FO3S
and a molecular weight of 516.76 g/mol. Its IUPAC name is S-(4-octoxyphenyl) 4-(2-fluorodecoxy)benzenecarbothioate.
Molecular Properties
| Compound Name | S-(4-octoxyphenyl) 4-(2-fluorodecoxy)benzenecarbothioate |
| PubChem CID | 14297710 |
| Molecular Formula | C31H45FO3S |
| Molecular Weight | 516.76 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | S-(4-octoxyphenyl) 4-(2-fluorodecoxy)benzenecarbothioate |
| SMILES | CCCCCCCCOc1ccc(SC(=O)c2ccc(OCC(F)CCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C31H45FO3S/c1-3-5-7-9-11-13-15-27(32)25-35-29-18-16-26(17-19-29)31(33)36-30-22-20-28(21-23-30)34-24-14-12-10-8-6-4-2/h16-23,27H,3-15,24-25H2,1-2H3 |
| InChIKey | RSBHWUDGSWIAFJ-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.76 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-octoxyphenyl) 4-(2-fluorodecoxy)benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-octoxyphenyl) 4-(2-fluorodecoxy)benzenecarbothioate?
The IUPAC name of S-(4-octoxyphenyl) 4-(2-fluorodecoxy)benzenecarbothioate (CID 14297710) is S-(4-octoxyphenyl) 4-(2-fluorodecoxy)benzenecarbothioate.
What is the SMILES notation for S-(4-octoxyphenyl) 4-(2-fluorodecoxy)benzenecarbothioate?
The canonical SMILES for S-(4-octoxyphenyl) 4-(2-fluorodecoxy)benzenecarbothioate is CCCCCCCCOc1ccc(SC(=O)c2ccc(OCC(F)CCCCCCCC)cc2)cc1.
What is the InChIKey of S-(4-octoxyphenyl) 4-(2-fluorodecoxy)benzenecarbothioate?
The InChIKey is RSBHWUDGSWIAFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H45FO3S/c1-3-5-7-9-11-13-15-27(32)25-35-29-18-16-26(17-19-29)31(33)36-30-22-20-28(21-23-30)34-24-14-12-10-8-6-4-2/h16-23,27H,3-15,24-25H2,1-2H3.
What are the key properties of S-(4-octoxyphenyl) 4-(2-fluorodecoxy)benzenecarbothioate?
S-(4-octoxyphenyl) 4-(2-fluorodecoxy)benzenecarbothioate has a molecular weight of 516.76 g/mol, XLogP of 9.83, 20 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-octoxyphenyl) 4-(2-fluorodecoxy)benzenecarbothioate is sourced from PubChem (CID 14297710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).