C40H44O8S — CID 155241850
ethenyl 6-[4-[7-[6-[2-(methoxymethyl)prop-2-enoyloxy]hexoxy]phenanthren-2-yl]sulfanylcarbonylphenoxy]hexanoate (PubChem CID 155241850) has the molecular formula C40H44O8S and a molecular weight of 684.85 g/mol. Its IUPAC name is ethenyl 6-[4-[7-[6-[2-(methoxymethyl)prop-2-enoyloxy]hexoxy]phenanthren-2-yl]sulfanylcarbonylphenoxy]hexanoate.
| Compound Name | ethenyl 6-[4-[7-[6-[2-(methoxymethyl)prop-2-enoyloxy]hexoxy]phenanthren-2-yl]sulfanylcarbonylphenoxy]hexanoate |
|---|---|
| PubChem CID | 155241850 |
| Molecular Formula | C40H44O8S |
| Molecular Weight | 684.85 g/mol |
| Exact Mass | 684.28 |
| IUPAC Name | ethenyl 6-[4-[7-[6-[2-(methoxymethyl)prop-2-enoyloxy]hexoxy]phenanthren-2-yl]sulfanylcarbonylphenoxy]hexanoate |
| SMILES | C=COC(=O)CCCCCOc1ccc(C(=O)Sc2ccc3c(ccc4cc(OCCCCCCOC(=O)C(=C)COC)ccc43)c2)cc1 |
| InChI | InChI=1S/C40H44O8S/c1-4-45-38(41)12-8-7-11-23-46-33-17-15-30(16-18-33)40(43)49-35-20-22-37-32(27-35)14-13-31-26-34(19-21-36(31)37)47-24-9-5-6-10-25-48-39(42)29(2)28-44-3/h4,13-22,26-27H,1-2,5-12,23-25,28H2,3H3 |
| InChIKey | XDAXJIRSFWSYJP-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.85 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|