C36H33NO7S — CID 155241611
ethenyl 6-[7-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]sulfanylcarbonylphenanthren-2-yl]oxyhexanoate (PubChem CID 155241611) has the molecular formula C36H33NO7S and a molecular weight of 623.73 g/mol. Its IUPAC name is ethenyl 6-[7-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]sulfanylcarbonylphenanthren-2-yl]oxyhexanoate.
| Compound Name | ethenyl 6-[7-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]sulfanylcarbonylphenanthren-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 155241611 |
| Molecular Formula | C36H33NO7S |
| Molecular Weight | 623.73 g/mol |
| Exact Mass | 623.20 |
| IUPAC Name | ethenyl 6-[7-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]sulfanylcarbonylphenanthren-2-yl]oxyhexanoate |
| SMILES | C=COC(=O)CCCCCOc1ccc2c(ccc3cc(C(=O)Sc4ccc(OCCCN5C(=O)C=CC5=O)cc4)ccc32)c1 |
| InChI | InChI=1S/C36H33NO7S/c1-2-42-35(40)7-4-3-5-21-44-29-13-17-32-26(24-29)9-8-25-23-27(10-16-31(25)32)36(41)45-30-14-11-28(12-15-30)43-22-6-20-37-33(38)18-19-34(37)39/h2,8-19,23-24H,1,3-7,20-22H2 |
| InChIKey | QVZCROLKATUQKZ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.73 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|