C35H30O7S — CID 155241831
4-O-cyclohexyl 1-O-[4-(7-prop-2-enoyloxyphenanthrene-2-carbonyl)sulfanylphenyl] 2-methylidenebutanedioate (PubChem CID 155241831) has the molecular formula C35H30O7S and a molecular weight of 594.69 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-[4-(7-prop-2-enoyloxyphenanthrene-2-carbonyl)sulfanylphenyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-cyclohexyl 1-O-[4-(7-prop-2-enoyloxyphenanthrene-2-carbonyl)sulfanylphenyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 155241831 |
| Molecular Formula | C35H30O7S |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | 4-O-cyclohexyl 1-O-[4-(7-prop-2-enoyloxyphenanthrene-2-carbonyl)sulfanylphenyl] 2-methylidenebutanedioate |
| SMILES | C=CC(=O)Oc1ccc2c(ccc3cc(C(=O)Sc4ccc(OC(=O)C(=C)CC(=O)OC5CCCCC5)cc4)ccc32)c1 |
| InChI | InChI=1S/C35H30O7S/c1-3-32(36)41-28-14-18-31-24(21-28)10-9-23-20-25(11-17-30(23)31)35(39)43-29-15-12-27(13-16-29)42-34(38)22(2)19-33(37)40-26-7-5-4-6-8-26/h3,9-18,20-21,26H,1-2,4-8,19H2 |
| InChIKey | YFEBLZJRQCHHHM-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|