C37H36O10 — CID 154625296
1-O-[4-[4-[4-(4-cyclohexyloxy-2-methylidene-4-oxobutanoyl)oxyphenyl]benzoyl]oxyphenyl] 4-O-ethyl 2-methylidenebutanedioate (PubChem CID 154625296) has the molecular formula C37H36O10 and a molecular weight of 640.68 g/mol. Its IUPAC name is 1-O-[4-[4-[4-(4-cyclohexyloxy-2-methylidene-4-oxobutanoyl)oxyphenyl]benzoyl]oxyphenyl] 4-O-ethyl 2-methylidenebutanedioate.
| Compound Name | 1-O-[4-[4-[4-(4-cyclohexyloxy-2-methylidene-4-oxobutanoyl)oxyphenyl]benzoyl]oxyphenyl] 4-O-ethyl 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154625296 |
| Molecular Formula | C37H36O10 |
| Molecular Weight | 640.68 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | 1-O-[4-[4-[4-(4-cyclohexyloxy-2-methylidene-4-oxobutanoyl)oxyphenyl]benzoyl]oxyphenyl] 4-O-ethyl 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OCC)C(=O)Oc1ccc(OC(=O)c2ccc(-c3ccc(OC(=O)C(=C)CC(=O)OC4CCCCC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H36O10/c1-4-43-33(38)22-24(2)35(40)46-31-18-20-32(21-19-31)47-37(42)28-12-10-26(11-13-28)27-14-16-30(17-15-27)45-36(41)25(3)23-34(39)44-29-8-6-5-7-9-29/h10-21,29H,2-9,22-23H2,1H3 |
| InChIKey | HZUHYHOTQABIDX-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.68 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|