C33H30O8 — CID 154624905
4-O-cyclohexyl 1-O-[4-[4-(4-prop-2-enoyloxyphenyl)phenoxy]carbonylphenyl] 2-methylidenebutanedioate (PubChem CID 154624905) has the molecular formula C33H30O8 and a molecular weight of 554.60 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-[4-[4-(4-prop-2-enoyloxyphenyl)phenoxy]carbonylphenyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-cyclohexyl 1-O-[4-[4-(4-prop-2-enoyloxyphenyl)phenoxy]carbonylphenyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154624905 |
| Molecular Formula | C33H30O8 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 4-O-cyclohexyl 1-O-[4-[4-(4-prop-2-enoyloxyphenyl)phenoxy]carbonylphenyl] 2-methylidenebutanedioate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(OC(=O)c3ccc(OC(=O)C(=C)CC(=O)OC4CCCCC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H30O8/c1-3-30(34)38-27-15-9-23(10-16-27)24-11-17-29(18-12-24)41-33(37)25-13-19-28(20-14-25)40-32(36)22(2)21-31(35)39-26-7-5-4-6-8-26/h3,9-20,26H,1-2,4-8,21H2 |
| InChIKey | LLKAJPZMMTYYSW-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|