C27H26O8 — CID 154624892
4-O-cyclohexyl 1-O-[4-(4-prop-2-enoyloxybenzoyl)oxyphenyl] 2-methylidenebutanedioate (PubChem CID 154624892) has the molecular formula C27H26O8 and a molecular weight of 478.50 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-[4-(4-prop-2-enoyloxybenzoyl)oxyphenyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-cyclohexyl 1-O-[4-(4-prop-2-enoyloxybenzoyl)oxyphenyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154624892 |
| Molecular Formula | C27H26O8 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 4-O-cyclohexyl 1-O-[4-(4-prop-2-enoyloxybenzoyl)oxyphenyl] 2-methylidenebutanedioate |
| SMILES | C=CC(=O)Oc1ccc(C(=O)Oc2ccc(OC(=O)C(=C)CC(=O)OC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C27H26O8/c1-3-24(28)32-21-11-9-19(10-12-21)27(31)35-23-15-13-22(14-16-23)34-26(30)18(2)17-25(29)33-20-7-5-4-6-8-20/h3,9-16,20H,1-2,4-8,17H2 |
| InChIKey | RCECBJWEFWAKPJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|